C17H16O6 — CID 168599708
[3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] cyclopropanecarboxylate (PubChem CID 168599708) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 168599708 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | [3-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]phenyl] cyclopropanecarboxylate |
| SMILES | CC1(C)OC(=O)C(=Cc2cccc(OC(=O)C3CC3)c2)C(=O)O1 |
| InChI | InChI=1S/C17H16O6/c1-17(2)22-15(19)13(16(20)23-17)9-10-4-3-5-12(8-10)21-14(18)11-6-7-11/h3-5,8-9,11H,6-7H2,1-2H3 |
| InChIKey | PQESBBMKBSVDMF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|