C15H20N4O2 — CID 168592350
[3-[(diaminomethylidenehydrazinylidene)methyl]phenyl] cyclohexanecarboxylate (PubChem CID 168592350) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is [3-[(diaminomethylidenehydrazinylidene)methyl]phenyl] cyclohexanecarboxylate.
| Compound Name | [3-[(diaminomethylidenehydrazinylidene)methyl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 168592350 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [3-[(diaminomethylidenehydrazinylidene)methyl]phenyl] cyclohexanecarboxylate |
| SMILES | NC(N)=NN=Cc1cccc(OC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C15H20N4O2/c16-15(17)19-18-10-11-5-4-8-13(9-11)21-14(20)12-6-2-1-3-7-12/h4-5,8-10,12H,1-3,6-7H2,(H4,16,17,19) |
| InChIKey | JRPYBCKUEXZYEZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|