C18H20N4O7S — CID 168623364
4-[3-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid (PubChem CID 168623364) has the molecular formula C18H20N4O7S and a molecular weight of 436.45 g/mol. Its IUPAC name is 4-[3-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid.
| Compound Name | 4-[3-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid |
|---|---|
| PubChem CID | 168623364 |
| Molecular Formula | C18H20N4O7S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 4-[3-[[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]-4-nitrophenoxy]butanoic acid |
| SMILES | CCOC(=O)Cc1csc(NN=Cc2cc(OCCCC(=O)O)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C18H20N4O7S/c1-2-28-17(25)9-13-11-30-18(20-13)21-19-10-12-8-14(5-6-15(12)22(26)27)29-7-3-4-16(23)24/h5-6,8,10-11H,2-4,7,9H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | LTHDYJXMORQJML-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 153.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|