C21H30N2O7 — CID 70434636
methyl 2-[cyclohexyl-[4-[3-(1-hydroxyethyl)-4-nitrophenoxy]butanoyl]amino]acetate (PubChem CID 70434636) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 2-[cyclohexyl-[4-[3-(1-hydroxyethyl)-4-nitrophenoxy]butanoyl]amino]acetate.
| Compound Name | methyl 2-[cyclohexyl-[4-[3-(1-hydroxyethyl)-4-nitrophenoxy]butanoyl]amino]acetate |
|---|---|
| PubChem CID | 70434636 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl 2-[cyclohexyl-[4-[3-(1-hydroxyethyl)-4-nitrophenoxy]butanoyl]amino]acetate |
| SMILES | COC(=O)CN(C(=O)CCCOc1ccc([N+](=O)[O-])c(C(C)O)c1)C1CCCCC1 |
| InChI | InChI=1S/C21H30N2O7/c1-15(24)18-13-17(10-11-19(18)23(27)28)30-12-6-9-20(25)22(14-21(26)29-2)16-7-4-3-5-8-16/h10-11,13,15-16,24H,3-9,12,14H2,1-2H3 |
| InChIKey | DHTJZTOIAHRQEZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|