C20H20N2O7 — CID 88663022
methyl 2-[N-[4-(3-formyl-4-nitrophenoxy)butanoyl]anilino]acetate (PubChem CID 88663022) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is methyl 2-[N-[4-(3-formyl-4-nitrophenoxy)butanoyl]anilino]acetate.
| Compound Name | methyl 2-[N-[4-(3-formyl-4-nitrophenoxy)butanoyl]anilino]acetate |
|---|---|
| PubChem CID | 88663022 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | methyl 2-[N-[4-(3-formyl-4-nitrophenoxy)butanoyl]anilino]acetate |
| SMILES | COC(=O)CN(C(=O)CCCOc1ccc([N+](=O)[O-])c(C=O)c1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O7/c1-28-20(25)13-21(16-6-3-2-4-7-16)19(24)8-5-11-29-17-9-10-18(22(26)27)15(12-17)14-23/h2-4,6-7,9-10,12,14H,5,8,11,13H2,1H3 |
| InChIKey | BLBCMDKSLDSQJC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|