C27H38N4O5 — CID 70434657
methyl 2-[4-[(1-butyl-2-oxo-3,5-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl-cyclohexylamino]acetate (PubChem CID 70434657) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is methyl 2-[4-[(1-butyl-2-oxo-3,5-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl-cyclohexylamino]acetate.
| Compound Name | methyl 2-[4-[(1-butyl-2-oxo-3,5-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl-cyclohexylamino]acetate |
|---|---|
| PubChem CID | 70434657 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | methyl 2-[4-[(1-butyl-2-oxo-3,5-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl-cyclohexylamino]acetate |
| SMILES | CCCCN1C(=O)CN2Cc3cc(OCCCC(=O)N(CC(=O)OC)C4CCCCC4)ccc3N=C21 |
| InChI | InChI=1S/C27H38N4O5/c1-3-4-14-30-25(33)18-29-17-20-16-22(12-13-23(20)28-27(29)30)36-15-8-11-24(32)31(19-26(34)35-2)21-9-6-5-7-10-21/h12-13,16,21H,3-11,14-15,17-19H2,1-2H3 |
| InChIKey | AFMALYFVWRKRPY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|