C35H55N5O3 — CID 54139960
4-[[2-amino-3-[2-[cyclohexyl(cyclopentyl)amino]-2-oxoethyl]-4H-quinazolin-6-yl]oxy]-N-butyl-N-cyclohexylbutanamide (PubChem CID 54139960) has the molecular formula C35H55N5O3 and a molecular weight of 593.86 g/mol. Its IUPAC name is 4-[[2-amino-3-[2-[cyclohexyl(cyclopentyl)amino]-2-oxoethyl]-4H-quinazolin-6-yl]oxy]-N-butyl-N-cyclohexylbutanamide.
| Compound Name | 4-[[2-amino-3-[2-[cyclohexyl(cyclopentyl)amino]-2-oxoethyl]-4H-quinazolin-6-yl]oxy]-N-butyl-N-cyclohexylbutanamide |
|---|---|
| PubChem CID | 54139960 |
| Molecular Formula | C35H55N5O3 |
| Molecular Weight | 593.86 g/mol |
| Exact Mass | 593.43 |
| IUPAC Name | 4-[[2-amino-3-[2-[cyclohexyl(cyclopentyl)amino]-2-oxoethyl]-4H-quinazolin-6-yl]oxy]-N-butyl-N-cyclohexylbutanamide |
| SMILES | CCCCN(C(=O)CCCOc1ccc2c(c1)CN(CC(=O)N(C1CCCCC1)C1CCCC1)C(N)=N2)C1CCCCC1 |
| InChI | InChI=1S/C35H55N5O3/c1-2-3-22-39(28-13-6-4-7-14-28)33(41)19-12-23-43-31-20-21-32-27(24-31)25-38(35(36)37-32)26-34(42)40(30-17-10-11-18-30)29-15-8-5-9-16-29/h20-21,24,28-30H,2-19,22-23,25-26H2,1H3,(H2,36,37) |
| InChIKey | OAKCHBXVZJSVAX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 91.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.86 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|