C26H36N4O5 — CID 135626539
3-[cyclohexyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]propyl acetate (PubChem CID 135626539) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is 3-[cyclohexyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]propyl acetate.
| Compound Name | 3-[cyclohexyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]propyl acetate |
|---|---|
| PubChem CID | 135626539 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 3-[cyclohexyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]propyl acetate |
| SMILES | CC(=O)OCCCN(C(=O)CCCCOc1ccc2c(c1)CN1CC(=O)NC1=N2)C1CCCCC1 |
| InChI | InChI=1S/C26H36N4O5/c1-19(31)34-15-7-13-30(21-8-3-2-4-9-21)25(33)10-5-6-14-35-22-11-12-23-20(16-22)17-29-18-24(32)28-26(29)27-23/h11-12,16,21H,2-10,13-15,17-18H2,1H3,(H,27,28,32) |
| InChIKey | OAMSDYBGMRPAJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|