C29H35N5O3 — CID 135773326
N-cyclohexyl-N-methyl-5-[(E)-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)-phenylmethylidene]amino]oxypentanamide (PubChem CID 135773326) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-5-[(E)-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)-phenylmethylidene]amino]oxypentanamide.
| Compound Name | N-cyclohexyl-N-methyl-5-[(E)-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)-phenylmethylidene]amino]oxypentanamide |
|---|---|
| PubChem CID | 135773326 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N-cyclohexyl-N-methyl-5-[(E)-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)-phenylmethylidene]amino]oxypentanamide |
| SMILES | CN(C(=O)CCCCO/N=C(\c1ccccc1)c1ccc2c(c1)CN1CC(=O)NC1=N2)C1CCCCC1 |
| InChI | InChI=1S/C29H35N5O3/c1-33(24-12-6-3-7-13-24)27(36)14-8-9-17-37-32-28(21-10-4-2-5-11-21)22-15-16-25-23(18-22)19-34-20-26(35)31-29(34)30-25/h2,4-5,10-11,15-16,18,24H,3,6-9,12-14,17,19-20H2,1H3,(H,30,31,35)/b32-28+ |
| InChIKey | SJHXMMSTDBNERO-VEWQFJOQSA-N |
| XLogP | 4.35 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|