C25H30N4O3 — CID 135626852
N-benzyl-N-methyl-7-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-6-yl)oxy]heptanamide (PubChem CID 135626852) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-benzyl-N-methyl-7-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-6-yl)oxy]heptanamide.
| Compound Name | N-benzyl-N-methyl-7-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-6-yl)oxy]heptanamide |
|---|---|
| PubChem CID | 135626852 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | N-benzyl-N-methyl-7-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-6-yl)oxy]heptanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCCCCCOc1cccc2c1CN1CC(=O)NC1=N2 |
| InChI | InChI=1S/C25H30N4O3/c1-28(16-19-10-5-4-6-11-19)24(31)14-7-2-3-8-15-32-22-13-9-12-21-20(22)17-29-18-23(30)27-25(29)26-21/h4-6,9-13H,2-3,7-8,14-18H2,1H3,(H,26,27,30) |
| InChIKey | DLVWDWONNQATIB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|