C23H26N4O3 — CID 135626702
N-methyl-6-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl)oxy]-N-phenylhexanamide (PubChem CID 135626702) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-methyl-6-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl)oxy]-N-phenylhexanamide.
| Compound Name | N-methyl-6-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl)oxy]-N-phenylhexanamide |
|---|---|
| PubChem CID | 135626702 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-methyl-6-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl)oxy]-N-phenylhexanamide |
| SMILES | CN(C(=O)CCCCCOc1cccc2c1N=C1NC(=O)CN1C2)c1ccccc1 |
| InChI | InChI=1S/C23H26N4O3/c1-26(18-10-4-2-5-11-18)21(29)13-6-3-7-14-30-19-12-8-9-17-15-27-16-20(28)24-23(27)25-22(17)19/h2,4-5,8-12H,3,6-7,13-16H2,1H3,(H,24,25,28) |
| InChIKey | YEZRPKJDIAEEFU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|