C25H36N4O5 — CID 135626317
N-cyclohexyl-N-(1-hydroxyethyl)-6-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl]oxy]hexanamide (PubChem CID 135626317) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-cyclohexyl-N-(1-hydroxyethyl)-6-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl]oxy]hexanamide.
| Compound Name | N-cyclohexyl-N-(1-hydroxyethyl)-6-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl]oxy]hexanamide |
|---|---|
| PubChem CID | 135626317 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | N-cyclohexyl-N-(1-hydroxyethyl)-6-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-9-yl]oxy]hexanamide |
| SMILES | CC(O)N(C(=O)CCCCCOc1cccc2c1N=C1NC(=O)C(CO)N1C2)C1CCCCC1 |
| InChI | InChI=1S/C25H36N4O5/c1-17(31)29(19-10-4-2-5-11-19)22(32)13-6-3-7-14-34-21-12-8-9-18-15-28-20(16-30)24(33)27-25(28)26-23(18)21/h8-9,12,17,19-20,30-31H,2-7,10-11,13-16H2,1H3,(H,26,27,33) |
| InChIKey | WDNDEKJTDSLLOW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|