C22H24N4O4 — CID 135626363
4-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl]oxy]-N-methyl-N-phenylbutanamide (PubChem CID 135626363) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl]oxy]-N-methyl-N-phenylbutanamide.
| Compound Name | 4-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl]oxy]-N-methyl-N-phenylbutanamide |
|---|---|
| PubChem CID | 135626363 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-[[3-(hydroxymethyl)-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl]oxy]-N-methyl-N-phenylbutanamide |
| SMILES | CN(C(=O)CCCOc1ccc2c(c1)CN1C(=N2)NC(=O)C1CO)c1ccccc1 |
| InChI | InChI=1S/C22H24N4O4/c1-25(16-6-3-2-4-7-16)20(28)8-5-11-30-17-9-10-18-15(12-17)13-26-19(14-27)21(29)24-22(26)23-18/h2-4,6-7,9-10,12,19,27H,5,8,11,13-14H2,1H3,(H,23,24,29) |
| InChIKey | PSPKCRUQMDVNJA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|