C22H23N3O4 — CID 135667990
3-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate (PubChem CID 135667990) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate.
| Compound Name | 3-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate |
|---|---|
| PubChem CID | 135667990 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 3-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate |
| SMILES | CC(=O)OCCCOc1ccc2c(c1)CN1C(=N2)NC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O4/c1-15(26)28-10-5-11-29-18-8-9-19-17(13-18)14-25-20(21(27)24-22(25)23-19)12-16-6-3-2-4-7-16/h2-4,6-9,13,20H,5,10-12,14H2,1H3,(H,23,24,27) |
| InChIKey | IZULVDFWMRCMEE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|