C27H32ClN3O4 — CID 135667857
8-[(3-benzyl-6-chloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]octyl acetate (PubChem CID 135667857) has the molecular formula C27H32ClN3O4 and a molecular weight of 498.02 g/mol. Its IUPAC name is 8-[(3-benzyl-6-chloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]octyl acetate.
| Compound Name | 8-[(3-benzyl-6-chloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]octyl acetate |
|---|---|
| PubChem CID | 135667857 |
| Molecular Formula | C27H32ClN3O4 |
| Molecular Weight | 498.02 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 8-[(3-benzyl-6-chloro-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]octyl acetate |
| SMILES | CC(=O)OCCCCCCCCOc1ccc2c(c1Cl)CN1C(=N2)NC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C27H32ClN3O4/c1-19(32)34-15-9-4-2-3-5-10-16-35-24-14-13-22-21(25(24)28)18-31-23(26(33)30-27(31)29-22)17-20-11-7-6-8-12-20/h6-8,11-14,23H,2-5,9-10,15-18H2,1H3,(H,29,30,33) |
| InChIKey | KZYXHSIMOSDLDE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.02 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|