C20H24ClN5O2 — CID 135667984
6-chloro-7-(6-imidazol-1-ylhexoxy)-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (PubChem CID 135667984) has the molecular formula C20H24ClN5O2 and a molecular weight of 401.90 g/mol. Its IUPAC name is 6-chloro-7-(6-imidazol-1-ylhexoxy)-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one.
| Compound Name | 6-chloro-7-(6-imidazol-1-ylhexoxy)-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
|---|---|
| PubChem CID | 135667984 |
| Molecular Formula | C20H24ClN5O2 |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 6-chloro-7-(6-imidazol-1-ylhexoxy)-3-methyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| SMILES | CC1C(=O)NC2=Nc3ccc(OCCCCCCn4ccnc4)c(Cl)c3CN21 |
| InChI | InChI=1S/C20H24ClN5O2/c1-14-19(27)24-20-23-16-6-7-17(18(21)15(16)12-26(14)20)28-11-5-3-2-4-9-25-10-8-22-13-25/h6-8,10,13-14H,2-5,9,11-12H2,1H3,(H,23,24,27) |
| InChIKey | PKBREIWPYRWLIA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|