C20H25N5O4 — CID 70454954
3-hydroxy-7-(5-imidazol-1-ylpentoxy)-6-methoxy-1-methyl-3,5-dihydroimidazo[2,1-b]quinazolin-2-one (PubChem CID 70454954) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-hydroxy-7-(5-imidazol-1-ylpentoxy)-6-methoxy-1-methyl-3,5-dihydroimidazo[2,1-b]quinazolin-2-one.
| Compound Name | 3-hydroxy-7-(5-imidazol-1-ylpentoxy)-6-methoxy-1-methyl-3,5-dihydroimidazo[2,1-b]quinazolin-2-one |
|---|---|
| PubChem CID | 70454954 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-hydroxy-7-(5-imidazol-1-ylpentoxy)-6-methoxy-1-methyl-3,5-dihydroimidazo[2,1-b]quinazolin-2-one |
| SMILES | COc1c(OCCCCCn2ccnc2)ccc2c1CN1C(=N2)N(C)C(=O)C1O |
| InChI | InChI=1S/C20H25N5O4/c1-23-18(26)19(27)25-12-14-15(22-20(23)25)6-7-16(17(14)28-2)29-11-5-3-4-9-24-10-8-21-13-24/h6-8,10,13,19,27H,3-5,9,11-12H2,1-2H3 |
| InChIKey | GLSDTOZXLRNUIU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|