C18H23N3O5 — CID 135668081
3-[(3-ethyl-6-methoxy-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate (PubChem CID 135668081) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 3-[(3-ethyl-6-methoxy-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate.
| Compound Name | 3-[(3-ethyl-6-methoxy-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate |
|---|---|
| PubChem CID | 135668081 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 3-[(3-ethyl-6-methoxy-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]propyl acetate |
| SMILES | CCC1C(=O)NC2=Nc3ccc(OCCCOC(C)=O)c(OC)c3CN21 |
| InChI | InChI=1S/C18H23N3O5/c1-4-14-17(23)20-18-19-13-6-7-15(26-9-5-8-25-11(2)22)16(24-3)12(13)10-21(14)18/h6-7,14H,4-5,8-10H2,1-3H3,(H,19,20,23) |
| InChIKey | JDTZFVDWVCNHGS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|