C24H24ClN5O2 — CID 135667787
3-benzyl-6-chloro-7-(4-imidazol-1-ylbutoxy)-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (PubChem CID 135667787) has the molecular formula C24H24ClN5O2 and a molecular weight of 449.94 g/mol. Its IUPAC name is 3-benzyl-6-chloro-7-(4-imidazol-1-ylbutoxy)-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one.
| Compound Name | 3-benzyl-6-chloro-7-(4-imidazol-1-ylbutoxy)-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
|---|---|
| PubChem CID | 135667787 |
| Molecular Formula | C24H24ClN5O2 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-benzyl-6-chloro-7-(4-imidazol-1-ylbutoxy)-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| SMILES | O=C1NC2=Nc3ccc(OCCCCn4ccnc4)c(Cl)c3CN2C1Cc1ccccc1 |
| InChI | InChI=1S/C24H24ClN5O2/c25-22-18-15-30-20(14-17-6-2-1-3-7-17)23(31)28-24(30)27-19(18)8-9-21(22)32-13-5-4-11-29-12-10-26-16-29/h1-3,6-10,12,16,20H,4-5,11,13-15H2,(H,27,28,31) |
| InChIKey | WZCLGHLFODDBFV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|