C30H40N4O4 — CID 70412679
2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]-3-methyl-3-phenylbutanoic acid (PubChem CID 70412679) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]-3-methyl-3-phenylbutanoic acid.
| Compound Name | 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]-3-methyl-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 70412679 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-4H-quinazolin-3-yl]-3-methyl-3-phenylbutanoic acid |
| SMILES | CN(C(=O)CCCOc1ccc2c(c1)CN(C(C(=O)O)C(C)(C)c1ccccc1)C(N)=N2)C1CCCCC1 |
| InChI | InChI=1S/C30H40N4O4/c1-30(2,22-11-6-4-7-12-22)27(28(36)37)34-20-21-19-24(16-17-25(21)32-29(34)31)38-18-10-15-26(35)33(3)23-13-8-5-9-14-23/h4,6-7,11-12,16-17,19,23,27H,5,8-10,13-15,18,20H2,1-3H3,(H2,31,32)(H,36,37) |
| InChIKey | HXAVLQVGDDEFHW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|