C27H36BrN5O3 — CID 135887917
4-[[2-amino-3-(2-anilino-2-oxoethyl)-1,4-dihydroquinazolin-3-ium-6-yl]oxy]-N-cyclohexyl-N-methylbutanamide bromide (PubChem CID 135887917) has the molecular formula C27H36BrN5O3 and a molecular weight of 558.52 g/mol. Its IUPAC name is 4-[[2-amino-3-(2-anilino-2-oxoethyl)-1,4-dihydroquinazolin-3-ium-6-yl]oxy]-N-cyclohexyl-N-methylbutanamide bromide.
| Compound Name | 4-[[2-amino-3-(2-anilino-2-oxoethyl)-1,4-dihydroquinazolin-3-ium-6-yl]oxy]-N-cyclohexyl-N-methylbutanamide bromide |
|---|---|
| PubChem CID | 135887917 |
| Molecular Formula | C27H36BrN5O3 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 4-[[2-amino-3-(2-anilino-2-oxoethyl)-1,4-dihydroquinazolin-3-ium-6-yl]oxy]-N-cyclohexyl-N-methylbutanamide bromide |
| SMILES | CN(C(=O)CCCOc1ccc2c(c1)C[N+](CC(=O)Nc1ccccc1)=C(N)N2)C1CCCCC1.[Br-] |
| InChI | InChI=1S/C27H35N5O3.BrH/c1-31(22-11-6-3-7-12-22)26(34)13-8-16-35-23-14-15-24-20(17-23)18-32(27(28)30-24)19-25(33)29-21-9-4-2-5-10-21;/h2,4-5,9-10,14-15,17,22H,3,6-8,11-13,16,18-19H2,1H3,(H3,28,29,30,33);1H |
| InChIKey | HDRPBAQDBNELPT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|