C20H26N4O5S — CID 135986072
N-cyclohexyl-N-methyl-4-[(2,2,5-trioxo-1,3-dihydro-[1,2,4]thiadiazolo[3,4-b]quinazolin-7-yl)oxy]butanamide (PubChem CID 135986072) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-[(2,2,5-trioxo-1,3-dihydro-[1,2,4]thiadiazolo[3,4-b]quinazolin-7-yl)oxy]butanamide.
| Compound Name | N-cyclohexyl-N-methyl-4-[(2,2,5-trioxo-1,3-dihydro-[1,2,4]thiadiazolo[3,4-b]quinazolin-7-yl)oxy]butanamide |
|---|---|
| PubChem CID | 135986072 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-[(2,2,5-trioxo-1,3-dihydro-[1,2,4]thiadiazolo[3,4-b]quinazolin-7-yl)oxy]butanamide |
| SMILES | CN(C(=O)CCCOc1ccc2nc3n(c(=O)c2c1)CS(=O)(=O)N3)C1CCCCC1 |
| InChI | InChI=1S/C20H26N4O5S/c1-23(14-6-3-2-4-7-14)18(25)8-5-11-29-15-9-10-17-16(12-15)19(26)24-13-30(27,28)22-20(24)21-17/h9-10,12,14H,2-8,11,13H2,1H3,(H,21,22) |
| InChIKey | ZVDSOLRKEJKCGJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|