C18H27ClN2O3 — CID 119443722
4-(3-acetylphenoxy)-N-methyl-N-piperidin-4-ylbutanamide;hydrochloride (PubChem CID 119443722) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is 4-(3-acetylphenoxy)-N-methyl-N-piperidin-4-ylbutanamide;hydrochloride.
| Compound Name | 4-(3-acetylphenoxy)-N-methyl-N-piperidin-4-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119443722 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 4-(3-acetylphenoxy)-N-methyl-N-piperidin-4-ylbutanamide;hydrochloride |
| SMILES | CC(=O)c1cccc(OCCCC(=O)N(C)C2CCNCC2)c1.Cl |
| InChI | InChI=1S/C18H26N2O3.ClH/c1-14(21)15-5-3-6-17(13-15)23-12-4-7-18(22)20(2)16-8-10-19-11-9-16;/h3,5-6,13,16,19H,4,7-12H2,1-2H3;1H |
| InChIKey | RXDIWGRQFDNLDU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|