C15H21FN2O2 — CID 119553657
4-(3-fluorophenoxy)-N-methyl-N-pyrrolidin-3-ylbutanamide (PubChem CID 119553657) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N-methyl-N-pyrrolidin-3-ylbutanamide.
| Compound Name | 4-(3-fluorophenoxy)-N-methyl-N-pyrrolidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119553657 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-(3-fluorophenoxy)-N-methyl-N-pyrrolidin-3-ylbutanamide |
| SMILES | CN(C(=O)CCCOc1cccc(F)c1)C1CCNC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-18(13-7-8-17-11-13)15(19)6-3-9-20-14-5-2-4-12(16)10-14/h2,4-5,10,13,17H,3,6-9,11H2,1H3 |
| InChIKey | KNYLNFTTXFBFNE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|