C16H21NO5 — CID 119232841
3-[4-(3-acetylphenoxy)butanoyl-methylamino]propanoic acid (PubChem CID 119232841) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[4-(3-acetylphenoxy)butanoyl-methylamino]propanoic acid.
| Compound Name | 3-[4-(3-acetylphenoxy)butanoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119232841 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[4-(3-acetylphenoxy)butanoyl-methylamino]propanoic acid |
| SMILES | CC(=O)c1cccc(OCCCC(=O)N(C)CCC(=O)O)c1 |
| InChI | InChI=1S/C16H21NO5/c1-12(18)13-5-3-6-14(11-13)22-10-4-7-15(19)17(2)9-8-16(20)21/h3,5-6,11H,4,7-10H2,1-2H3,(H,20,21) |
| InChIKey | KUYHMOVAFTWNHD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|