C26H38N4O4 — CID 135626645
4-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N,N-dihexylbutanamide (PubChem CID 135626645) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N,N-dihexylbutanamide.
| Compound Name | 4-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N,N-dihexylbutanamide |
|---|---|
| PubChem CID | 135626645 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 4-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N,N-dihexylbutanamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)CCCOc1ccc2nc3n(c(=O)c2c1)CC(=O)N3 |
| InChI | InChI=1S/C26H38N4O4/c1-3-5-7-9-15-29(16-10-8-6-4-2)24(32)12-11-17-34-20-13-14-22-21(18-20)25(33)30-19-23(31)28-26(30)27-22/h13-14,18H,3-12,15-17,19H2,1-2H3,(H,27,28,31) |
| InChIKey | REDYGQUHCRXLJP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|