C25H36N4O5 — CID 135626501
3-[hexyl-[4-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl]amino]propyl acetate (PubChem CID 135626501) has the molecular formula C25H36N4O5 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[hexyl-[4-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl]amino]propyl acetate.
| Compound Name | 3-[hexyl-[4-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl]amino]propyl acetate |
|---|---|
| PubChem CID | 135626501 |
| Molecular Formula | C25H36N4O5 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 3-[hexyl-[4-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]butanoyl]amino]propyl acetate |
| SMILES | CCCCCCN(CCCOC(C)=O)C(=O)CCCOc1ccc2c(c1)CN1CC(=O)NC1=N2 |
| InChI | InChI=1S/C25H36N4O5/c1-3-4-5-6-12-28(13-8-15-33-19(2)30)24(32)9-7-14-34-21-10-11-22-20(16-21)17-29-18-23(31)27-25(29)26-22/h10-11,16H,3-9,12-15,17-18H2,1-2H3,(H,26,27,31) |
| InChIKey | CDCBCIIMAGSSMT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|