C27H38N4O5 — CID 135626763
1-[1-cyclopentylpropyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]ethyl acetate (PubChem CID 135626763) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 1-[1-cyclopentylpropyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]ethyl acetate.
| Compound Name | 1-[1-cyclopentylpropyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 135626763 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 1-[1-cyclopentylpropyl-[5-[(2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]pentanoyl]amino]ethyl acetate |
| SMILES | CCC(C1CCCC1)N(C(=O)CCCCOc1ccc2c(c1)CN1CC(=O)NC1=N2)C(C)OC(C)=O |
| InChI | InChI=1S/C27H38N4O5/c1-4-24(20-9-5-6-10-20)31(18(2)36-19(3)32)26(34)11-7-8-14-35-22-12-13-23-21(15-22)16-30-17-25(33)29-27(30)28-23/h12-13,15,18,20,24H,4-11,14,16-17H2,1-3H3,(H,28,29,33) |
| InChIKey | YMCNEAGCWXKOLN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|