C24H32N4O4 — CID 135626606
N-cyclohexyl-7-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N-methylheptanamide (PubChem CID 135626606) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-cyclohexyl-7-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N-methylheptanamide.
| Compound Name | N-cyclohexyl-7-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N-methylheptanamide |
|---|---|
| PubChem CID | 135626606 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-cyclohexyl-7-[(2,5-dioxo-1,3-dihydroimidazo[2,1-b]quinazolin-7-yl)oxy]-N-methylheptanamide |
| SMILES | CN(C(=O)CCCCCCOc1ccc2nc3n(c(=O)c2c1)CC(=O)N3)C1CCCCC1 |
| InChI | InChI=1S/C24H32N4O4/c1-27(17-9-5-4-6-10-17)22(30)11-7-2-3-8-14-32-18-12-13-20-19(15-18)23(31)28-16-21(29)26-24(28)25-20/h12-13,15,17H,2-11,14,16H2,1H3,(H,25,26,29) |
| InChIKey | OKUAPDFIFNOIJO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|