C23H35N4O4+ — CID 135887904
ethyl 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-1,4-dihydroquinazolin-3-ium-3-yl]acetate (PubChem CID 135887904) has the molecular formula C23H35N4O4+ and a molecular weight of 431.56 g/mol. Its IUPAC name is ethyl 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-1,4-dihydroquinazolin-3-ium-3-yl]acetate.
| Compound Name | ethyl 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-1,4-dihydroquinazolin-3-ium-3-yl]acetate |
|---|---|
| PubChem CID | 135887904 |
| Molecular Formula | C23H35N4O4+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | ethyl 2-[2-amino-6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-1,4-dihydroquinazolin-3-ium-3-yl]acetate |
| SMILES | CCOC(=O)C[N+]1=C(N)Nc2ccc(OCCCC(=O)N(C)C3CCCCC3)cc2C1 |
| InChI | InChI=1S/C23H34N4O4/c1-3-30-22(29)16-27-15-17-14-19(11-12-20(17)25-23(27)24)31-13-7-10-21(28)26(2)18-8-5-4-6-9-18/h11-12,14,18H,3-10,13,15-16H2,1-2H3,(H2,24,25)/p+1 |
| InChIKey | MSGATJYNCMZCIQ-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|