C28H42N4O6 — CID 70061853
tert-butyl 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-(ethoxycarbonylamino)-4H-quinazolin-3-yl]acetate (PubChem CID 70061853) has the molecular formula C28H42N4O6 and a molecular weight of 530.67 g/mol. Its IUPAC name is tert-butyl 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-(ethoxycarbonylamino)-4H-quinazolin-3-yl]acetate.
| Compound Name | tert-butyl 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-(ethoxycarbonylamino)-4H-quinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 70061853 |
| Molecular Formula | C28H42N4O6 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | tert-butyl 2-[6-[4-[cyclohexyl(methyl)amino]-4-oxobutoxy]-2-(ethoxycarbonylamino)-4H-quinazolin-3-yl]acetate |
| SMILES | CCOC(=O)NC1=Nc2ccc(OCCCC(=O)N(C)C3CCCCC3)cc2CN1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H42N4O6/c1-6-36-27(35)30-26-29-23-15-14-22(17-20(23)18-32(26)19-25(34)38-28(2,3)4)37-16-10-13-24(33)31(5)21-11-8-7-9-12-21/h14-15,17,21H,6-13,16,18-19H2,1-5H3,(H,29,30,35) |
| InChIKey | FGXFOBPTHGKPDX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|