C40H51N5O3 — CID 135707783
N,N-dicyclohexyl-4-[[2-methylimino-3-[2-oxo-2-[(3-phenylphenyl)methylamino]ethyl]-1,4-dihydroquinazolin-6-yl]oxy]butanamide (PubChem CID 135707783) has the molecular formula C40H51N5O3 and a molecular weight of 649.88 g/mol. Its IUPAC name is N,N-dicyclohexyl-4-[[2-methylimino-3-[2-oxo-2-[(3-phenylphenyl)methylamino]ethyl]-1,4-dihydroquinazolin-6-yl]oxy]butanamide.
| Compound Name | N,N-dicyclohexyl-4-[[2-methylimino-3-[2-oxo-2-[(3-phenylphenyl)methylamino]ethyl]-1,4-dihydroquinazolin-6-yl]oxy]butanamide |
|---|---|
| PubChem CID | 135707783 |
| Molecular Formula | C40H51N5O3 |
| Molecular Weight | 649.88 g/mol |
| Exact Mass | 649.40 |
| IUPAC Name | N,N-dicyclohexyl-4-[[2-methylimino-3-[2-oxo-2-[(3-phenylphenyl)methylamino]ethyl]-1,4-dihydroquinazolin-6-yl]oxy]butanamide |
| SMILES | C/N=C1\Nc2ccc(OCCCC(=O)N(C3CCCCC3)C3CCCCC3)cc2CN1CC(=O)NCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C40H51N5O3/c1-41-40-43-37-23-22-36(48-24-12-21-39(47)45(34-17-7-3-8-18-34)35-19-9-4-10-20-35)26-33(37)28-44(40)29-38(46)42-27-30-13-11-16-32(25-30)31-14-5-2-6-15-31/h2,5-6,11,13-16,22-23,25-26,34-35H,3-4,7-10,12,17-21,24,27-29H2,1H3,(H,41,43)(H,42,46) |
| InChIKey | YJLIPJIQWARXPS-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.88 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|