C19H28N2O4 — CID 119907001
1-[2-[(3-butoxyphenyl)methylamino]-2-oxoethyl]piperidine-4-carboxylic acid (PubChem CID 119907001) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[2-[(3-butoxyphenyl)methylamino]-2-oxoethyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[(3-butoxyphenyl)methylamino]-2-oxoethyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119907001 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[2-[(3-butoxyphenyl)methylamino]-2-oxoethyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1cccc(CNC(=O)CN2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C19H28N2O4/c1-2-3-11-25-17-6-4-5-15(12-17)13-20-18(22)14-21-9-7-16(8-10-21)19(23)24/h4-6,12,16H,2-3,7-11,13-14H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | RFYDLIYVWWQNNY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|