C22H34N2O3 — CID 55749602
N-[(3-butoxyphenyl)methyl]-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide (PubChem CID 55749602) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[(3-butoxyphenyl)methyl]-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55749602 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide |
| SMILES | CCCCOc1cccc(CNC(=O)C2CCN(C(=O)C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H34N2O3/c1-5-6-14-27-19-9-7-8-17(15-19)16-23-20(25)18-10-12-24(13-11-18)21(26)22(2,3)4/h7-9,15,18H,5-6,10-14,16H2,1-4H3,(H,23,25) |
| InChIKey | CQHUTBBZRZJCAE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|