C21H32N2O3 — CID 55906919
N-(2-butoxyphenyl)-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide (PubChem CID 55906919) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-(2-butoxyphenyl)-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-(2-butoxyphenyl)-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55906919 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | N-(2-butoxyphenyl)-1-(2,2-dimethylpropanoyl)piperidine-4-carboxamide |
| SMILES | CCCCOc1ccccc1NC(=O)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H32N2O3/c1-5-6-15-26-18-10-8-7-9-17(18)22-19(24)16-11-13-23(14-12-16)20(25)21(2,3)4/h7-10,16H,5-6,11-15H2,1-4H3,(H,22,24) |
| InChIKey | VDSVMGJUAIFNBK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|