C21H29F3N2O4 — CID 33228480
1-(2,2-dimethylpropanoyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 33228480) has the molecular formula C21H29F3N2O4 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 33228480 |
| Molecular Formula | C21H29F3N2O4 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H29F3N2O4/c1-20(2,3)19(28)26-9-7-14(8-10-26)18(27)25-16-13-15(21(22,23)24)5-6-17(16)30-12-11-29-4/h5-6,13-14H,7-12H2,1-4H3,(H,25,27) |
| InChIKey | YNPSMECSZRPLJO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|