C19H29N3O3 — CID 87035683
1-N-(2-butoxyphenyl)-4-N,4-N-dimethylpiperidine-1,4-dicarboxamide (PubChem CID 87035683) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-N-(2-butoxyphenyl)-4-N,4-N-dimethylpiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(2-butoxyphenyl)-4-N,4-N-dimethylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 87035683 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 1-N-(2-butoxyphenyl)-4-N,4-N-dimethylpiperidine-1,4-dicarboxamide |
| SMILES | CCCCOc1ccccc1NC(=O)N1CCC(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C19H29N3O3/c1-4-5-14-25-17-9-7-6-8-16(17)20-19(24)22-12-10-15(11-13-22)18(23)21(2)3/h6-9,15H,4-5,10-14H2,1-3H3,(H,20,24) |
| InChIKey | PPCCDNLTOXFAJN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|