C19H27FN2O3 — CID 37361348
1-(2,2-dimethylpropanoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-4-carboxamide (PubChem CID 37361348) has the molecular formula C19H27FN2O3 and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 37361348 |
| Molecular Formula | C19H27FN2O3 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[2-(4-fluorophenoxy)ethyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCC(C(=O)NCCOc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H27FN2O3/c1-19(2,3)18(24)22-11-8-14(9-12-22)17(23)21-10-13-25-16-6-4-15(20)5-7-16/h4-7,14H,8-13H2,1-3H3,(H,21,23) |
| InChIKey | YAPGAYPJSIJZBH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|