C16H22N2O4 — CID 119905107
1-[2-[(3-ethoxyphenyl)methylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 119905107) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[2-[(3-ethoxyphenyl)methylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[(3-ethoxyphenyl)methylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119905107 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[2-[(3-ethoxyphenyl)methylamino]-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCOc1cccc(CNC(=O)CN2CCC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H22N2O4/c1-2-22-14-5-3-4-12(8-14)9-17-15(19)11-18-7-6-13(10-18)16(20)21/h3-5,8,13H,2,6-7,9-11H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | AZFLSVVUGQGCKG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |