C23H36N4O3 — CID 78899307
2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-[(3-ethoxyphenyl)methyl]acetamide (PubChem CID 78899307) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-[(3-ethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-[(3-ethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 78899307 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-[(3-ethoxyphenyl)methyl]acetamide |
| SMILES | CCOc1cccc(CNC(=O)CN2CCN(CC(=O)N3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C23H36N4O3/c1-2-30-21-9-7-8-20(16-21)17-24-22(28)18-25-12-14-26(15-13-25)19-23(29)27-10-5-3-4-6-11-27/h7-9,16H,2-6,10-15,17-19H2,1H3,(H,24,28) |
| InChIKey | WIRVSUIHWFIJGQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |