C32H44N4O4 — CID 68614595
5-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]heptanoic acid (PubChem CID 68614595) has the molecular formula C32H44N4O4 and a molecular weight of 548.73 g/mol. Its IUPAC name is 5-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]heptanoic acid.
| Compound Name | 5-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]heptanoic acid |
|---|---|
| PubChem CID | 68614595 |
| Molecular Formula | C32H44N4O4 |
| Molecular Weight | 548.73 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 5-[[(4S)-4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexylbutanoyl]-methylamino]heptanoic acid |
| SMILES | CCC(CCCC(=O)O)N(C)C(=O)CC[C@@H](C1CCCCC1)N1Cc2cc(Oc3ccccc3)ccc2N=C1N |
| InChI | InChI=1S/C32H44N4O4/c1-3-25(13-10-16-31(38)39)35(2)30(37)20-19-29(23-11-6-4-7-12-23)36-22-24-21-27(17-18-28(24)34-32(36)33)40-26-14-8-5-9-15-26/h5,8-9,14-15,17-18,21,23,25,29H,3-4,6-7,10-13,16,19-20,22H2,1-2H3,(H2,33,34)(H,38,39)/t25?,29-/m0/s1 |
| InChIKey | YEFRSISWPKFCKT-QFCCLOIZSA-N |
| XLogP | 6.46 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |