C31H44N4O4 — CID 67023485
4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexyl-N-[1-hydroxy-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]butanamide (PubChem CID 67023485) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is 4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexyl-N-[1-hydroxy-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]butanamide.
| Compound Name | 4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexyl-N-[1-hydroxy-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]butanamide |
|---|---|
| PubChem CID | 67023485 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 4-(2-amino-6-phenoxy-4H-quinazolin-3-yl)-4-cyclohexyl-N-[1-hydroxy-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]butanamide |
| SMILES | CC(C)(C)OCC(CO)NC(=O)CCC(C1CCCCC1)N1Cc2cc(Oc3ccccc3)ccc2N=C1N |
| InChI | InChI=1S/C31H44N4O4/c1-31(2,3)38-21-24(20-36)33-29(37)17-16-28(22-10-6-4-7-11-22)35-19-23-18-26(14-15-27(23)34-30(35)32)39-25-12-8-5-9-13-25/h5,8-9,12-15,18,22,24,28,36H,4,6-7,10-11,16-17,19-21H2,1-3H3,(H2,32,34)(H,33,37) |
| InChIKey | CLCXCHDJXXSQNZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |