C30H44N4O5 — CID 67023473
methyl 2-[[(4R)-4-[(5-amino-2-phenoxy-4-pyridinyl)methylamino]-4-cyclohexylbutanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 67023473) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is methyl 2-[[(4R)-4-[(5-amino-2-phenoxy-4-pyridinyl)methylamino]-4-cyclohexylbutanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-[[(4R)-4-[(5-amino-2-phenoxy-4-pyridinyl)methylamino]-4-cyclohexylbutanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 67023473 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | methyl 2-[[(4R)-4-[(5-amino-2-phenoxy-4-pyridinyl)methylamino]-4-cyclohexylbutanoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COC(=O)C(COC(C)(C)C)NC(=O)CC[C@@H](NCc1cc(Oc2ccccc2)ncc1N)C1CCCCC1 |
| InChI | InChI=1S/C30H44N4O5/c1-30(2,3)38-20-26(29(36)37-4)34-27(35)16-15-25(21-11-7-5-8-12-21)32-18-22-17-28(33-19-24(22)31)39-23-13-9-6-10-14-23/h6,9-10,13-14,17,19,21,25-26,32H,5,7-8,11-12,15-16,18,20,31H2,1-4H3,(H,34,35)/t25-,26?/m1/s1 |
| InChIKey | WQQPCBSUXTZAMQ-DCWQJPKNSA-N |
| XLogP | 4.75 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |