C21H34N2O4 — CID 153486880
tert-butyl (2S)-2-[3-(benzylamino)propanoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 153486880) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-(benzylamino)propanoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl (2S)-2-[3-(benzylamino)propanoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 153486880 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | tert-butyl (2S)-2-[3-(benzylamino)propanoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)(C)OC[C@H](NC(=O)CCNCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H34N2O4/c1-20(2,3)26-15-17(19(25)27-21(4,5)6)23-18(24)12-13-22-14-16-10-8-7-9-11-16/h7-11,17,22H,12-15H2,1-6H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | XZBADQLQMFFQOH-KRWDZBQOSA-N |
| XLogP | 2.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|