About tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate
tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 3766020) has the molecular formula C20H32N2O4
and a molecular weight of 364.49 g/mol. Its IUPAC name is tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| PubChem CID | 3766020 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | Cc1cc(C)cc(NC(=O)NC(COC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H32N2O4/c1-13-9-14(2)11-15(10-13)21-18(24)22-16(12-25-19(3,4)5)17(23)26-20(6,7)8/h9-11,16H,12H2,1-8H3,(H2,21,22,24) |
| InChIKey | HVNPTZMCSJQVNQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate?
The IUPAC name of tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (CID 3766020) is tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
What is the SMILES notation for tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate?
The canonical SMILES for tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate is Cc1cc(C)cc(NC(=O)NC(COC(C)(C)C)C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate?
The InChIKey is HVNPTZMCSJQVNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2O4/c1-13-9-14(2)11-15(10-13)21-18(24)22-16(12-25-19(3,4)5)17(23)26-20(6,7)8/h9-11,16H,12H2,1-8H3,(H2,21,22,24).
What are the key properties of tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate?
tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate has a molecular weight of 364.49 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(3,5-dimethylphenyl)carbamoylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate is sourced from PubChem (CID 3766020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).