C20H32N2O4S — CID 5018735
tert-butyl 2-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 5018735) has the molecular formula C20H32N2O4S and a molecular weight of 396.55 g/mol. Its IUPAC name is tert-butyl 2-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 5018735 |
| Molecular Formula | C20H32N2O4S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | tert-butyl 2-[(4-methoxy-2-methylphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COc1ccc(NC(=S)NC(COC(C)(C)C)C(=O)OC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C20H32N2O4S/c1-13-11-14(24-8)9-10-15(13)21-18(27)22-16(12-25-19(2,3)4)17(23)26-20(5,6)7/h9-11,16H,12H2,1-8H3,(H2,21,22,27) |
| InChIKey | MBBYBDFXYILGDQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|