C20H32N2O5S — CID 3866064
tert-butyl 2-[(2,5-dimethoxyphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 3866064) has the molecular formula C20H32N2O5S and a molecular weight of 412.55 g/mol. Its IUPAC name is tert-butyl 2-[(2,5-dimethoxyphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-[(2,5-dimethoxyphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 3866064 |
| Molecular Formula | C20H32N2O5S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | tert-butyl 2-[(2,5-dimethoxyphenyl)carbamothioylamino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | COc1ccc(OC)c(NC(=S)NC(COC(C)(C)C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H32N2O5S/c1-19(2,3)26-12-15(17(23)27-20(4,5)6)22-18(28)21-14-11-13(24-7)9-10-16(14)25-8/h9-11,15H,12H2,1-8H3,(H2,21,22,28) |
| InChIKey | USULTPNXRXJPCU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|