C37H46N4O6 — CID 68958372
benzyl 2-[cyclohexyl-[4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]acetate (PubChem CID 68958372) has the molecular formula C37H46N4O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is benzyl 2-[cyclohexyl-[4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]acetate.
| Compound Name | benzyl 2-[cyclohexyl-[4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]acetate |
|---|---|
| PubChem CID | 68958372 |
| Molecular Formula | C37H46N4O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | benzyl 2-[cyclohexyl-[4-cyclohexyl-4-[(5-nitro-2-phenoxy-4-pyridinyl)methylamino]butanoyl]amino]acetate |
| SMILES | O=C(CN(C(=O)CCC(NCc1cc(Oc2ccccc2)ncc1[N+](=O)[O-])C1CCCCC1)C1CCCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C37H46N4O6/c42-36(40(31-17-9-3-10-18-31)26-37(43)46-27-28-13-5-1-6-14-28)22-21-33(29-15-7-2-8-16-29)38-24-30-23-35(39-25-34(30)41(44)45)47-32-19-11-4-12-20-32/h1,4-6,11-14,19-20,23,25,29,31,33,38H,2-3,7-10,15-18,21-22,24,26-27H2 |
| InChIKey | ZXHYAFFDJJCELY-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|