C26H31N3O7 — CID 46504468
ethyl 2-[benzyl-[2-(cyclohexylamino)-1-(6-nitro-1,3-benzodioxol-5-yl)-2-oxoethyl]amino]acetate (PubChem CID 46504468) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is ethyl 2-[benzyl-[2-(cyclohexylamino)-1-(6-nitro-1,3-benzodioxol-5-yl)-2-oxoethyl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[2-(cyclohexylamino)-1-(6-nitro-1,3-benzodioxol-5-yl)-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 46504468 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | ethyl 2-[benzyl-[2-(cyclohexylamino)-1-(6-nitro-1,3-benzodioxol-5-yl)-2-oxoethyl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(C(=O)NC1CCCCC1)c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C26H31N3O7/c1-2-34-24(30)16-28(15-18-9-5-3-6-10-18)25(26(31)27-19-11-7-4-8-12-19)20-13-22-23(36-17-35-22)14-21(20)29(32)33/h3,5-6,9-10,13-14,19,25H,2,4,7-8,11-12,15-17H2,1H3,(H,27,31) |
| InChIKey | ISGFZQOFAMVVQA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|