C28H29N3O5 — CID 15995637
N-cyclopentyl-2-(dibenzylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 15995637) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is N-cyclopentyl-2-(dibenzylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(dibenzylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 15995637 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-cyclopentyl-2-(dibenzylamino)-2-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | O=C(NC1CCCC1)C(c1cc2c(cc1[N+](=O)[O-])OCO2)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H29N3O5/c32-28(29-22-13-7-8-14-22)27(23-15-25-26(36-19-35-25)16-24(23)31(33)34)30(17-20-9-3-1-4-10-20)18-21-11-5-2-6-12-21/h1-6,9-12,15-16,22,27H,7-8,13-14,17-19H2,(H,29,32) |
| InChIKey | DPVTYIBYUDEXAH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|